5-Methylisophthalic acid

Product name 5-Methylisophthalic acid
synonym 5-Methylbenzene-1,3-dicarboxylic acid; 5-methylisophthalic acid; Uvitic acid; 5-methylbenzene-1,3-dicarboxylate
CAS NO. 499-49-0
EINECS NO. 207-881-2
Molecular formula C9H6O4
Molecular weight 178.1426
InChI InChI=1/C9H8O4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)/p-2
Molecular structure  
Density
Melting point 299-303℃
Boiling point 408.7°C at 760 mmHg
Flash point 215.1°C
Vapor pressure 2.06E-07mmHg at 25°C
Risk terms S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.